Urolithin B ufa

November 9, 2020

Cofttek ndiye wopanga ufa wabwino kwambiri wa Urolithin B ku China. Fakitale yathu ili ndi dongosolo lathunthu loyang'anira kupanga (ISO9001 & ISO14001), lomwe limatha kupanga 200kg pamwezi.

 


Chikhalidwe: Mu Kupanga Misa
Unit: 1kg / thumba, 25kg / Drum

Urolithin BSzizindikiro

Name: Urolithin B
Dzina la mankhwala: 3-Hydroxy-6H-dibenzo [b, d] pyran-6-imodzi
CAS: 1139-83-9
Fomula Chemical: C13H8O3
Kulemera kwa maselo: 212.2 g / mol
mtundu;  White powder
Mfuko la InChi: Gawo #: WXUQMTRHPNOXBV-UHFFFAOYSA-N
NTHAWI ZONSE: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
ntchito; Urolithin B amatha kukonza mitochondrial ndi minofu ntchito.

Urolithin B imatha kukonza minofu yolimba komanso kupirira pakukalamba.

ntchito: Urolithin B ndi ofunikira am'mimba ochepa a ellagitannis ndikuwonetsa zochitika zothandizira anti-oxidant ndi pro-oxidant kutengera dongosolo ndi momwe zinthu zilili. Urolithin B amathanso kuwonetsa ntchito ya estrogenic ndi / kapena anti-estrogenic.
Kutupa: Kusungunuka mosavuta mu N, N-dimethylformamide ndi dimethylmethylene. Sulfone, sungunuka pang'ono mu methanol, ethanol, ndi ethyl acetate
Kusungirako nyengo: Zosakaniza, -20 ° C Freezer, Pansi pa malo osadziwika
Zotumiza: Kutumizidwa pansi pa kutentha monga mankhwala osakhala oopsa. Chogulitsa chimenechi n'chokhazikika kwa masabata angapo panthawi yamtundu wamba komanso nthawi yomwe amatha ku Customs.

 

Urolithin B Makina a NMR

Urolithin B (1139-83-9) - Makina a NMR

 

Ngati mukufuna COA, MSDS, HNMR pagulu lililonse lazogulitsa ndi zina, chonde lemberani oyang'anira malonda.

 

Chiyambi cha Urolithins

Urolithins ndi ma metabolites achiwiri a ellagic acid ochokera ku ellagitannins. Mwa anthu ellagitannins amasinthidwa ndimatumbo microflora kukhala ellagic acid yomwe imasinthidwanso kukhala urolithins A, urolithin B, urolithin C ndi urolithin D m'matumbo akulu.

Urolithin A (UA) ndiye mankhwala ofala kwambiri a ellagitannins. Komabe, urolithin A sichidziwika kuti imachitika mwachilengedwe pazakudya zilizonse.

Urolithin B (UB) ndi metabolism yochuluka yomwe imapangidwa m'matumbo kudzera pakusintha kwa ellagitannins. Urolithin B ndiye chinthu chomaliza pambuyo poti mankhwala ena onse a urolithin adulitsidwa. Urolithin B imapezeka mumkodzo monga urolithin B glucuronide.

Urolithin A 8-Methyl Ether ndi mankhwala apakatikati pa kaphatikizidwe ka Urolithin A. Ndi mankhwala ofunika kwambiri a ellagitannin ndipo ali ndi antioxidant ndi anti-inflammatory properties.

 

Njira yogwiritsira ntchito urolithin A ndi B

● Urolithin A amalimbikitsa mitophagy

Mitophagy ndi mtundu umodzi wa autophagy womwe umathandiza kuthetsa mitochondrial yowonongeka chifukwa chogwira bwino ntchito. Autophagy imatanthawuza njira yomwe ma cytoplasmic omwe amawonongeka amayamba kusinthidwa pomwe mitophagy ndikuwonongeka ndikuyambiranso kwa mitochondria.

Pakukalamba kuchepa kwa autophagy ndi chinthu chimodzi chomwe chimapangitsa kuchepa kwa ntchito ya mitochondrial. Kuphatikiza apo, kupsinjika kwa oxidative kumatha kupangitsanso kutsika kwa autophagy. Urolithin A amatha kuthana ndi mitochondria yowonongeka pogwiritsa ntchito autophagy.

● Mankhwala a antioxidant

Kupanikizika kwa oxidative kumachitika pakakhala kusamvana pakati pa zoyeserera zaulere ndi antioxidant m'thupi. Izi zopitilira muyeso zamagetsi nthawi zambiri zimagwirizanitsidwa ndi matenda ambiri a mtima monga matenda a mtima, shuga ndi khansa.

Urolithins A ndi B akuwonetsa zotsatira za antioxidant mwa kuthekera kwawo kuchepetsa ma radicals aulere makamaka makulidwe a intracellular reactive oxygen (ROS) komanso amalepheretsa lipid peroxidation m'mitundu ina yamaselo.

Kuphatikiza apo, ma urolithin amatha kuletsa ma enzyme a oxidizing, kuphatikiza monoamine oxidase A ndi tyrosinase.

● Mankhwala oletsa kutupa

Kutupa ndimachitidwe achilengedwe momwe matupi athu amalimbana ndi chilichonse chomwe chagwera monga matenda, kuvulala, ndi tizilombo tating'onoting'ono. Komabe, kutupa kosatha kumatha kukhala kovulaza thupi chifukwa izi zimalumikizidwa ndi zovuta zosiyanasiyana monga mphumu, mavuto amtima, ndi khansa. Kutupa kosatha kumatha kuchitika chifukwa cha kutupa kosaneneka, matenda opatsirana kapenanso kusintha kwaulere mthupi.

Urolithins A ndi B amawonetsa katundu wotsutsa-kufooka mwa kuletsa kupanga kwa nitric oxide. Amalepheretsa mapuloteni osakanikirana a nitric oxide synthase (iNOS) ndi mRNA omwe amachititsa kutupa.

● Zotsutsana ndi tizilombo tating'onoting'ono

Tizilombo tating'onoting'ono kuphatikizapo mabakiteriya, bowa ndi ma virus timachitika mwachilengedwe komanso m'thupi la munthu. Komabe, ma virus ochepa otchedwa ma tizilombo toyambitsa matenda amatha kuyambitsa matenda opatsirana monga chimfine, chikuku ndi malungo.

Urolithin A ndi B amatha kuwonetsa zochita za antimicrobial poletsa chidwi cha quorum. Kuzindikira kwa Quorum ndi njira yolankhulirana ya mabakiteriya yomwe imathandizira mabakiteriya kudziwa ndikuwongolera njira zokhudzana ndi matenda monga virulence ndi motility.

● Kuletsa mapuloteni glycation

Glycation amatanthauza kuphatikiza kwa shuga kopanda enzymatic. Ndizofunikira kwambiri pa matenda ashuga komanso mavuto ena komanso kukalamba.

Kutsekeka kwamapuloteni kwambiri ndi njira yachiwiri ya hyperglycemia kumathandizira kwambiri pamavuto okhudzana ndi mtima monga matenda a shuga komanso matenda a Alzheimer's.

Urolithin A ndi B ali ndi zinthu zotsutsana ndi glycative zomwe zimadalira mlingo womwe umayimira pawokha pantchito yawo ya antioxidant.

 

Urolithin B amapindula

Mankhwala a Urolithin B amakhalanso ndi maubwino angapo azaumoyo ndipo ambiri amafanana ndi mapindu a urolithin A.

(1) Kutha kwa khansa
Mphamvu yotsutsa-yotupa ya urolithin B imapangitsa kukhala woyenera kumenya khansa. Ofufuza ena adanenanso kuti izi zingatheke mu ma fibroblasts, microphages ndi maselo a endothelial.

Kafukufuku wanena kuti UB amaletsa khansa yamtundu wosiyanasiyana monga kansa ya prostate, colon ndi chikhodzodzo.

Kafukufuku wokhudzana ndi maselo a khansa ya m'matumbo a anthu, ma ellagitannins, ellagic acid ndi urolithins A ndi B adayesedwa kuti athe kulimbana ndi khansa. Adanenanso kuti mankhwalawa adathandizira kuletsa kukula kwa maselo a khansa. Analepheretsa maselo a khansa kuchulukana kudzera mwa kuwazungulira kwa maselo am'magawo osiyanasiyana komanso polimbikitsa kupopa.

(2) Ingathandize kulimbana ndi kupsyinjika kwa oxidative
Urolithin B ali ndi zida zabwino kwambiri za antioxidant pochepetsa mitundu yama oxygen yokhazikika komanso lipidation ya lipid m'mitundu ina. Mlingo waukulu wa ROS umalumikizidwa ndi zovuta zambiri monga matenda a Alzheimer's.

Pakufufuza komwe kumachitika ndi ma cell a neuronal omwe ali ndi nkhawa ya oxidative, urolithin B komanso urolithin A adapezeka kuti ateteza maselo ku oxidation motero adakulitsa kupulumuka.

(3) Urolithin B pakupititsa patsogolo kukumbukira
Urolithin b wanenedwa kuti akukonzanso magazi otchinga magazi. Izi zimathandizira magwiridwe antchito yanzeru.

Kafukufuku akuwonetsa kuti urolithin B akhoza kupititsa patsogolo kukumbukira mwa kusintha magwiridwe anthawi zonse.

(4) Imaletsa kutayika kwa minofu
Kuchepetsa minofu kumatha kuchitika chifukwa cha zifukwa zosiyanasiyana monga kusokonezeka, ukalamba ndi kuchepa kwa mapuloteni muzakudya. Njira zingapo zopewa, kuchepetsa kapena kupewa kuteteza minofu kuphatikiza, masewera olimbitsa thupi, mankhwala osokoneza bongo komanso ma amino acid komanso polyphenols angagwiritsidwe ntchito.

Urolithins amatha kutchulidwa kuti ma polyphenols ndipo amatenga nawo gawo popewa kuchepa kwa minofu poyambitsa kuphatikiza minofu ya protein komanso kuchepetsa kuchepa.

Pakufufuza ndi mbewa, Urolithin B zowonjezera zomwe zimaperekedwa kwa nthawi yayitali zimapezeka kuti zimalimbikitsa minofu yawo kukulira momwe minofu imawonedwa ikukulira.

(5) Urolithin B amalimbana ndi kutupa
Urolithin B ali ndi katundu wotsutsa-kutupa pochepetsa zilembo zambiri zotupa.

Pakufufuza makoswe okhala ndi impso fibrosis, urolithin B adapezeka kuti akondweretsa kuvulala kwa impso. Zinawonjezera ntchito ya aimpso, ma morphology a impso komanso kuchepetsa chikhomo cha impso. Izi zikuwonetsa kuti UB anali wokhoza kuchepetsa kutupa.

(6) Ubwino wamaubwenzi a urolithin A ndi B
Zotsatira za Synergistic zafotokozedwanso kuphatikiza urolithin A ndi B pakugwira ntchito mozindikira komanso kuthekera. Kafukufukuyu adati kuphatikiza uku kungagwiritsidwe ntchito pochiza kapena kupewa zovuta zokhudzana ndi matenda amisala monga nkhawa kapena matenda a Alzheimer's.

Mapindu ena omwe amaphatikizidwa ndi urolithins ndi;

  • neuroprotection
  • Ameliorates kagayidwe kachakudya matenda

 

Magulu a chakudya a Urolithin A ndi B

Ma urolithin sakudziwika kuti amapezeka mwachilengedwe muzinthu zilizonse zamagulu azakudya. Ndiwopezeka mukusinthidwa kwa ma ellagic acids omwe amachokera ku ellagitannins. Ellagitannins amasinthidwa kukhala ma ellagic acids ndi gut micobiota ndipo ellagic acid imasinthidwanso kukhala metabolites (urolithins) m'matumbo akulu.

Ellagitannins amapezeka mwachilengedwe m'malo opangira zakudya monga makangaza, zipatso monga strawberries, raspberries, cloudberries ndi mabulosi akuda, mphesa za muscadine, ma almond, magwafa, tiyi, ndi mtedza monga walnuts ndi mabokosi komanso zakumwa za oak monga vinyo wofiira ndi kachasu migolo ya thundu.

Chifukwa chake titha kumaliza kuti urolithin A zakudya ndi zakudya za urolithin B ndi zakudya zokhala ndi ellagitannin. Tiyenera kudziwa kuti ellagitannin bioavailability ndiyochepa pomwe ma metabolites ake achiwiri (urolithins) sapezeka mosavuta.

Kutulutsa ndi Urolithins kumasiyana mosiyanasiyana pakati pa anthu kuyambira pomwe kutembenuka kuchokera ku ellagitannins kudalira microbiota m'matumbo. Pali mabakiteriya enieni omwe amatenga nawo mbali pakusintha kumeneku ndipo amasiyanasiyana pakati pa anthu omwe ena ali ndi microbiota wokwera, wotsika kapena wopanda. Zakudya zimasiyananso m'magulu awo a ellagitannins. Chifukwa chake maubwino omwe ma ellagitannins angakhale nawo amasiyana malinga ndi munthu wina.

 

Zowonjezera za Urolithin A ndi B

Ma supplements a Urolithin A komanso ma Urolithin B othandizira amapezeka mosavuta mumsika ngati zakudya zowonjezera ellagitannin. Mankhwala a Urolithin A amapezekanso mosavuta. Makamaka makangaza omwe amathandizira akhala akugulitsidwa kwambiri ndikugwiritsidwa ntchito bwino. Zowonjezera izi zimapangidwa kuchokera kuzipatso kapena mtedza ndikupanga mawonekedwe amadzimadzi kapena a ufa.

Chifukwa cha kusiyanasiyana kwama ellagitannins muzakudya zosiyanasiyana, makasitomala a urolithin amagula poganizira komwe chakudya chimachokera. Zomwezo zimagwiranso ntchito mukamayang'ana ufa wa urolithin B kapena zowonjezera madzi.

Kafukufuku wowerengeka wa anthu omwe amapangidwa ndi urolithin A ufa kapena B sanafotokoze zovuta zilizonse chifukwa chothandizidwa ndi izi.

Reference

  1. Garcia-Munoz, Cristina; Vaillant, Fabrice (2014-12-02). "Thupi la Metabolic la Ellagitannins: Zokhudza Zaumoyo, ndi Kafukufuku Wokhudzana ndi Zakudya Zosintha Zatsopano". Ndemanga Zoyipa mu Science Science ndi Nutrition.
  2. Bialonska D, Kasimsetty SG, Khan SI, Ferreira D (11 Novembala 2009). "Urolithins, m'mimba ma microbial metabolites a Pomegranate ellagitannins, amawonetsa mphamvu ya antioxidant pazochita zoyeserera". J Agric Chakudya Chem.
  3. Bodwell, Graham; Pottie, Ian; Nandaluru, Penchal (2011). .