Urolithin B (1139-83-9, fakitale yopanga

Urolithin B

November 9, 2020

Urolithin BSzizindikiro

Name: Urolithin B
Dzina la mankhwala: 3-Hydroxy-6H-dibenzo [b, d] pyran-6-imodzi
CAS: 1139-83-9
Fomula Chemical: C13H8O3
Kulemera kwa maselo: 212.2 g / mol
mtundu;  White powder
Mfuko la InChi: Gawo #: WXUQMTRHPNOXBV-UHFFFAOYSA-N
NTHAWI ZONSE: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
ntchito; Urolithin B amatha kukonza mitochondrial ndi minofu ntchito.

Urolithin B imatha kukonza minofu yolimba komanso kupirira pakukalamba.

ntchito: Urolithin B ndi ofunikira am'mimba ochepa a ellagitannis ndikuwonetsa zochitika zothandizira anti-oxidant ndi pro-oxidant kutengera dongosolo ndi momwe zinthu zilili. Urolithin B amathanso kuwonetsa ntchito ya estrogenic ndi / kapena anti-estrogenic.
Kutupa: Kusungunuka mosavuta mu N, N-dimethylformamide ndi dimethylmethylene. Sulfone, sungunuka pang'ono mu methanol, ethanol, ndi ethyl acetate
Kusungirako nyengo: Zosakaniza, -20 ° C Freezer, Pansi pa malo osadziwika
Zotumiza: Kutumizidwa pansi pa kutentha monga mankhwala osakhala oopsa. Chogulitsa chimenechi n'chokhazikika kwa masabata angapo panthawi yamtundu wamba komanso nthawi yomwe amatha ku Customs.